C21H23NO5S — CID 139058358
diethyl (1S,3S,4R)-3-cyano-3-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hept-5-ene-2,2-dicarboxylate (PubChem CID 139058358) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is diethyl (1S,3S,4R)-3-cyano-3-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hept-5-ene-2,2-dicarboxylate.
| Compound Name | diethyl (1S,3S,4R)-3-cyano-3-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hept-5-ene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 139058358 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | diethyl (1S,3S,4R)-3-cyano-3-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hept-5-ene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H]2C=C[C@@H](C2)[C@]1(C#N)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H23NO5S/c1-4-26-18(23)21(19(24)27-5-2)16-9-8-15(12-16)20(21,13-22)28(25)17-10-6-14(3)7-11-17/h6-11,15-16H,4-5,12H2,1-3H3/t15-,16+,20-,28-/m0/s1 |
| InChIKey | XFIUTSKPZATWQQ-AIQFOMFISA-N |
| XLogP | 2.68 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|