C9H8N2O4 — CID 139063775
2-hydroxy-3,4-dioxocyclobuten-1-olate;pyridin-1-ium-4-amine (PubChem CID 139063775) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 2-hydroxy-3,4-dioxocyclobuten-1-olate;pyridin-1-ium-4-amine.
| Compound Name | 2-hydroxy-3,4-dioxocyclobuten-1-olate;pyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 139063775 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-hydroxy-3,4-dioxocyclobuten-1-olate;pyridin-1-ium-4-amine |
| SMILES | Nc1cc[nH+]cc1.O=c1c([O-])c(O)c1=O |
| InChI | InChI=1S/C5H6N2.C4H2O4/c6-5-1-3-7-4-2-5;5-1-2(6)4(8)3(1)7/h1-4H,(H2,6,7);5-6H |
| InChIKey | RAGSOUMQDZSETM-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|