C13H12N2O6 — CID 139198075
2-carboxy-3,5-dihydroxyphenolate;pyridin-1-ium-4-carboxamide (PubChem CID 139198075) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is 2-carboxy-3,5-dihydroxyphenolate;pyridin-1-ium-4-carboxamide.
| Compound Name | 2-carboxy-3,5-dihydroxyphenolate;pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 139198075 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-carboxy-3,5-dihydroxyphenolate;pyridin-1-ium-4-carboxamide |
| SMILES | NC(=O)c1cc[nH+]cc1.O=C(O)c1c([O-])cc(O)cc1O |
| InChI | InChI=1S/C7H6O5.C6H6N2O/c8-3-1-4(9)6(7(11)12)5(10)2-3;7-6(9)5-1-3-8-4-2-5/h1-2,8-10H,(H,11,12);1-4H,(H2,7,9) |
| InChIKey | OFZAGNNIABVSSK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |