C10H7Br5O — CID 139067391
(1R,2S)-1,2,4,5,7-pentabromo-6-methoxy-2,3-dihydro-1H-indene (PubChem CID 139067391) has the molecular formula C10H7Br5O and a molecular weight of 542.69 g/mol. Its IUPAC name is (1R,2S)-1,2,4,5,7-pentabromo-6-methoxy-2,3-dihydro-1H-indene.
| Compound Name | (1R,2S)-1,2,4,5,7-pentabromo-6-methoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 139067391 |
| Molecular Formula | C10H7Br5O |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 537.64 |
| IUPAC Name | (1R,2S)-1,2,4,5,7-pentabromo-6-methoxy-2,3-dihydro-1H-indene |
| SMILES | COc1c(Br)c(Br)c2c(c1Br)[C@@H](Br)[C@@H](Br)C2 |
| InChI | InChI=1S/C10H7Br5O/c1-16-10-8(14)5-3(6(12)9(10)15)2-4(11)7(5)13/h4,7H,2H2,1H3/t4-,7-/m0/s1 |
| InChIKey | OBQMQLMDYUCOKV-FFWSUHOLSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|