C20H37ClN6 — CID 139073237
6-chloro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 139073237) has the molecular formula C20H37ClN6 and a molecular weight of 397.01 g/mol. Its IUPAC name is 6-chloro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139073237 |
| Molecular Formula | C20H37ClN6 |
| Molecular Weight | 397.01 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 6-chloro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(C)CC(C)(C)Nc1nc(Cl)nc(NC2CC(C)(C)NC(C)(C)C2)n1 |
| InChI | InChI=1S/C20H37ClN6/c1-17(2,3)12-20(8,9)26-16-24-14(21)23-15(25-16)22-13-10-18(4,5)27-19(6,7)11-13/h13,27H,10-12H2,1-9H3,(H2,22,23,24,25,26) |
| InChIKey | VUMYHPRTIXJROB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.01 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |