C20H14BNO2 — CID 139073984
(2S)-spiro[3-oxa-1-azonia-2-boranuidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene-2,7'-8-oxa-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene] (PubChem CID 139073984) has the molecular formula C20H14BNO2 and a molecular weight of 311.15 g/mol. Its IUPAC name is (2S)-spiro[3-oxa-1-azonia-2-boranuidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene-2,7'-8-oxa-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene].
| Compound Name | (2S)-spiro[3-oxa-1-azonia-2-boranuidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene-2,7'-8-oxa-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
|---|---|
| PubChem CID | 139073984 |
| Molecular Formula | C20H14BNO2 |
| Molecular Weight | 311.15 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (2S)-spiro[3-oxa-1-azonia-2-boranuidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene-2,7'-8-oxa-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
| SMILES | c1ccc2c(c1)CO[B@-]21Oc2cccc3ccc4ccc[n+]1c4c23 |
| InChI | InChI=1S/C20H14BNO2/c1-2-8-17-16(5-1)13-23-21(17)22-12-4-7-15-11-10-14-6-3-9-18(24-21)19(14)20(15)22/h1-12H,13H2/t21-/m0/s1 |
| InChIKey | IINHGQJBVXEEEN-NRFANRHFSA-N |
| XLogP | 2.90 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|