C44H34N8O4 — CID 139075355
terephthalic acid;bis(10,11,12,13-tetrahydroquinoxalino[2,3-f][1,10]phenanthroline) (PubChem CID 139075355) has the molecular formula C44H34N8O4 and a molecular weight of 738.81 g/mol. Its IUPAC name is terephthalic acid;bis(10,11,12,13-tetrahydroquinoxalino[2,3-f][1,10]phenanthroline).
| Compound Name | terephthalic acid;bis(10,11,12,13-tetrahydroquinoxalino[2,3-f][1,10]phenanthroline) |
|---|---|
| PubChem CID | 139075355 |
| Molecular Formula | C44H34N8O4 |
| Molecular Weight | 738.81 g/mol |
| Exact Mass | 738.27 |
| IUPAC Name | terephthalic acid;bis(10,11,12,13-tetrahydroquinoxalino[2,3-f][1,10]phenanthroline) |
| SMILES | O=C(O)c1ccc(C(=O)O)cc1.c1cnc2c(c1)c1nc3c(nc1c1cccnc12)CCCC3.c1cnc2c(c1)c1nc3c(nc1c1cccnc12)CCCC3 |
| InChI | InChI=1S/2C18H14N4.C8H6O4/c2*1-2-8-14-13(7-1)21-17-11-5-3-9-19-15(11)16-12(18(17)22-14)6-4-10-20-16;9-7(10)5-1-2-6(4-3-5)8(11)12/h2*3-6,9-10H,1-2,7-8H2;1-4H,(H,9,10)(H,11,12) |
| InChIKey | FLFSEXGGPFOATH-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.81 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|