C36H64N4O14 — CID 139077087
4,11,14,17,24,31,34,37,43,48-decaoxa-1,7,21,27-tetrazatricyclo[25.13.5.57,21]pentacontane-2,6,22,26-tetrone (PubChem CID 139077087) has the molecular formula C36H64N4O14 and a molecular weight of 776.92 g/mol. Its IUPAC name is 4,11,14,17,24,31,34,37,43,48-decaoxa-1,7,21,27-tetrazatricyclo[25.13.5.57,21]pentacontane-2,6,22,26-tetrone.
| Compound Name | 4,11,14,17,24,31,34,37,43,48-decaoxa-1,7,21,27-tetrazatricyclo[25.13.5.57,21]pentacontane-2,6,22,26-tetrone |
|---|---|
| PubChem CID | 139077087 |
| Molecular Formula | C36H64N4O14 |
| Molecular Weight | 776.92 g/mol |
| Exact Mass | 776.44 |
| IUPAC Name | 4,11,14,17,24,31,34,37,43,48-decaoxa-1,7,21,27-tetrazatricyclo[25.13.5.57,21]pentacontane-2,6,22,26-tetrone |
| SMILES | O=C1COCC(=O)N2CCCOCCOCCOCCCN(CCOCC2)C(=O)COCC(=O)N2CCCOCCOCCOCCCN1CCOCC2 |
| InChI | InChI=1S/C36H64N4O14/c41-33-29-53-30-34(42)39-7-3-15-47-23-27-52-28-24-48-16-4-8-40(12-20-50-19-11-39)36(44)32-54-31-35(43)38-6-2-14-46-22-26-51-25-21-45-13-1-5-37(33)9-17-49-18-10-38/h1-32H2 |
| InChIKey | VZUTUPNALXUELT-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 173.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.92 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|