About (4-methoxyphenyl)azanium iodide
(4-methoxyphenyl)azanium iodide (PubChem CID 139080030) has the molecular formula C7H10INO
and a molecular weight of 251.07 g/mol. Its IUPAC name is (4-methoxyphenyl)azanium iodide.
Molecular Properties
| Compound Name | (4-methoxyphenyl)azanium iodide |
| PubChem CID | 139080030 |
| Molecular Formula | C7H10INO |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | (4-methoxyphenyl)azanium iodide |
| SMILES | COc1ccc([NH3+])cc1.[I-] |
| InChI | InChI=1S/C7H9NO.HI/c1-9-7-4-2-6(8)3-5-7;/h2-5H,8H2,1H3;1H |
| InChIKey | QRFXELVDJSDWHX-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl)azanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)azanium iodide?
The IUPAC name of (4-methoxyphenyl)azanium iodide (CID 139080030) is (4-methoxyphenyl)azanium iodide.
What is the SMILES notation for (4-methoxyphenyl)azanium iodide?
The canonical SMILES for (4-methoxyphenyl)azanium iodide is COc1ccc([NH3+])cc1.[I-].
What is the InChIKey of (4-methoxyphenyl)azanium iodide?
The InChIKey is QRFXELVDJSDWHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.HI/c1-9-7-4-2-6(8)3-5-7;/h2-5H,8H2,1H3;1H.
What are the key properties of (4-methoxyphenyl)azanium iodide?
(4-methoxyphenyl)azanium iodide has a molecular weight of 251.07 g/mol, XLogP of -2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)azanium iodide is sourced from PubChem (CID 139080030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).