About CID 14687696
CID 14687696 (PubChem CID 14687696) has the molecular formula C14H14O2Sb
and a molecular weight of 336.02 g/mol.
Molecular Properties
| Compound Name | CID 14687696 |
| PubChem CID | 14687696 |
| Molecular Formula | C14H14O2Sb |
| Molecular Weight | 336.02 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | — |
| SMILES | COc1ccc([Sb]c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/2C7H7O.Sb/c2*1-8-7-5-3-2-4-6-7;/h2*3-6H,1H3; |
| InChIKey | HXTLEDWBUBSLQP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.02 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 14687696 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 14687696?
The IUPAC name of CID 14687696 (CID 14687696) is not available.
What is the SMILES notation for CID 14687696?
The canonical SMILES for CID 14687696 is COc1ccc([Sb]c2ccc(OC)cc2)cc1.
What is the InChIKey of CID 14687696?
The InChIKey is HXTLEDWBUBSLQP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7O.Sb/c2*1-8-7-5-3-2-4-6-7;/h2*3-6H,1H3;.
What are the key properties of CID 14687696?
CID 14687696 has a molecular weight of 336.02 g/mol, XLogP of 1.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 14687696 is sourced from PubChem (CID 14687696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).