C30H38N4O6S2 — CID 139082473
(2-aminophenyl)methyl-[2-[(2-aminophenyl)methylazaniumyl]ethyl]azanium;bis(4-methylbenzenesulfonate) (PubChem CID 139082473) has the molecular formula C30H38N4O6S2 and a molecular weight of 614.79 g/mol. Its IUPAC name is (2-aminophenyl)methyl-[2-[(2-aminophenyl)methylazaniumyl]ethyl]azanium;bis(4-methylbenzenesulfonate).
| Compound Name | (2-aminophenyl)methyl-[2-[(2-aminophenyl)methylazaniumyl]ethyl]azanium;bis(4-methylbenzenesulfonate) |
|---|---|
| PubChem CID | 139082473 |
| Molecular Formula | C30H38N4O6S2 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | (2-aminophenyl)methyl-[2-[(2-aminophenyl)methylazaniumyl]ethyl]azanium;bis(4-methylbenzenesulfonate) |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1.Nc1ccccc1C[NH2+]CC[NH2+]Cc1ccccc1N |
| InChI | InChI=1S/C16H22N4.2C7H8O3S/c17-15-7-3-1-5-13(15)11-19-9-10-20-12-14-6-2-4-8-16(14)18;2*1-6-2-4-7(5-3-6)11(8,9)10/h1-8,19-20H,9-12,17-18H2;2*2-5H,1H3,(H,8,9,10) |
| InChIKey | NZIDWADLCHMTMS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 199.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|