C20H21NO3S — CID 139812719
benzyl(phenyl)azanium;4-methylbenzenesulfonate (PubChem CID 139812719) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is benzyl(phenyl)azanium;4-methylbenzenesulfonate.
| Compound Name | benzyl(phenyl)azanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139812719 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | benzyl(phenyl)azanium;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.c1ccc(C[NH2+]c2ccccc2)cc1 |
| InChI | InChI=1S/C13H13N.C7H8O3S/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;1-6-2-4-7(5-3-6)11(8,9)10/h1-10,14H,11H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | LBRVBOQRMLWXNV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|