C33H23N2O6Sm — CID 139085827
tris(2-formylphenolate);1,10-phenanthroline;samarium(3+) (PubChem CID 139085827) has the molecular formula C33H23N2O6Sm and a molecular weight of 693.92 g/mol. Its IUPAC name is tris(2-formylphenolate);1,10-phenanthroline;samarium(3+).
| Compound Name | tris(2-formylphenolate);1,10-phenanthroline;samarium(3+) |
|---|---|
| PubChem CID | 139085827 |
| Molecular Formula | C33H23N2O6Sm |
| Molecular Weight | 693.92 g/mol |
| Exact Mass | 695.08 |
| IUPAC Name | tris(2-formylphenolate);1,10-phenanthroline;samarium(3+) |
| SMILES | O=Cc1ccccc1[O-].O=Cc1ccccc1[O-].O=Cc1ccccc1[O-].[Sm+3].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.3C7H6O2.Sm/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3*8-5-6-3-1-2-4-7(6)9;/h1-8H;3*1-5,9H;/q;;;;+3/p-3 |
| InChIKey | DYSXWEWFGXORMQ-UHFFFAOYSA-K |
| XLogP | 4.50 |
| TPSA | 146.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.92 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|