C19H20ClNO — CID 139088514
(2S,3R,6R)-3-(2-chloroethyl)-2,6-diphenylpiperidin-4-one (PubChem CID 139088514) has the molecular formula C19H20ClNO and a molecular weight of 313.83 g/mol. Its IUPAC name is (2S,3R,6R)-3-(2-chloroethyl)-2,6-diphenylpiperidin-4-one.
| Compound Name | (2S,3R,6R)-3-(2-chloroethyl)-2,6-diphenylpiperidin-4-one |
|---|---|
| PubChem CID | 139088514 |
| Molecular Formula | C19H20ClNO |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (2S,3R,6R)-3-(2-chloroethyl)-2,6-diphenylpiperidin-4-one |
| SMILES | O=C1C[C@H](c2ccccc2)N[C@H](c2ccccc2)[C@H]1CCCl |
| InChI | InChI=1S/C19H20ClNO/c20-12-11-16-18(22)13-17(14-7-3-1-4-8-14)21-19(16)15-9-5-2-6-10-15/h1-10,16-17,19,21H,11-13H2/t16-,17+,19+/m0/s1 |
| InChIKey | ZPSQKFKTGHZJMH-YQVWRLOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|