C35H28O2 — CID 139089483
(1S,2R,9R,10S,11S,13S)-1-hydroxy-2,10-dimethyl-9,14,15-triphenylpentacyclo[8.5.0.02,13.03,8.09,11]pentadeca-3,5,7,14-tetraen-12-one (PubChem CID 139089483) has the molecular formula C35H28O2 and a molecular weight of 480.61 g/mol. Its IUPAC name is (1S,2R,9R,10S,11S,13S)-1-hydroxy-2,10-dimethyl-9,14,15-triphenylpentacyclo[8.5.0.02,13.03,8.09,11]pentadeca-3,5,7,14-tetraen-12-one.
| Compound Name | (1S,2R,9R,10S,11S,13S)-1-hydroxy-2,10-dimethyl-9,14,15-triphenylpentacyclo[8.5.0.02,13.03,8.09,11]pentadeca-3,5,7,14-tetraen-12-one |
|---|---|
| PubChem CID | 139089483 |
| Molecular Formula | C35H28O2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (1S,2R,9R,10S,11S,13S)-1-hydroxy-2,10-dimethyl-9,14,15-triphenylpentacyclo[8.5.0.02,13.03,8.09,11]pentadeca-3,5,7,14-tetraen-12-one |
| SMILES | C[C@@]12[C@H]3C(=O)[C@H]4C(c5ccccc5)=C(c5ccccc5)[C@]1(O)[C@@]4(C)c1ccccc1[C@]32c1ccccc1 |
| InChI | InChI=1S/C35H28O2/c1-32-25-20-12-13-21-26(25)34(24-18-10-5-11-19-24)31-30(36)29(32)27(22-14-6-3-7-15-22)28(23-16-8-4-9-17-23)35(32,37)33(31,34)2/h3-21,29,31,37H,1-2H3/t29-,31-,32+,33+,34-,35+/m1/s1 |
| InChIKey | WBKLNCZUZBSWPX-NCAMPDDHSA-N |
| XLogP | 6.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|