C76H66N4O10 — CID 139090680
bis(2,6-dibutyl-4,8-bis(2-phenylethynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone);1,4-dimethoxybenzene (PubChem CID 139090680) has the molecular formula C76H66N4O10 and a molecular weight of 1195.38 g/mol. Its IUPAC name is bis(2,6-dibutyl-4,8-bis(2-phenylethynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone);1,4-dimethoxybenzene.
| Compound Name | bis(2,6-dibutyl-4,8-bis(2-phenylethynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone);1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 139090680 |
| Molecular Formula | C76H66N4O10 |
| Molecular Weight | 1195.38 g/mol |
| Exact Mass | 1194.48 |
| IUPAC Name | bis(2,6-dibutyl-4,8-bis(2-phenylethynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone);1,4-dimethoxybenzene |
| SMILES | CCCCn1c(=O)c2c(C#Cc3ccccc3)c3c(=O)n(CCCC)c(=O)c3c(C#Cc3ccccc3)c2c1=O.CCCCn1c(=O)c2c(C#Cc3ccccc3)c3c(=O)n(CCCC)c(=O)c3c(C#Cc3ccccc3)c2c1=O.COc1ccc(OC)cc1 |
| InChI | InChI=1S/2C34H28N2O4.C8H10O2/c2*1-3-5-21-35-31(37)27-25(19-17-23-13-9-7-10-14-23)29-30(34(40)36(33(29)39)22-6-4-2)26(28(27)32(35)38)20-18-24-15-11-8-12-16-24;1-9-7-3-5-8(10-2)6-4-7/h2*7-16H,3-6,21-22H2,1-2H3;3-6H,1-2H3 |
| InChIKey | XPPAXROMDDHJDW-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 174.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 90 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1195.38 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|