C24H68Si10 — CID 139097581
trimethyl-[[2,2,3,3,5,5,6,6-octamethyl-1,4,4-tris(trimethylsilylmethyl)hexasilinan-1-yl]methyl]silane (PubChem CID 139097581) has the molecular formula C24H68Si10 and a molecular weight of 637.67 g/mol. Its IUPAC name is trimethyl-[[2,2,3,3,5,5,6,6-octamethyl-1,4,4-tris(trimethylsilylmethyl)hexasilinan-1-yl]methyl]silane.
| Compound Name | trimethyl-[[2,2,3,3,5,5,6,6-octamethyl-1,4,4-tris(trimethylsilylmethyl)hexasilinan-1-yl]methyl]silane |
|---|---|
| PubChem CID | 139097581 |
| Molecular Formula | C24H68Si10 |
| Molecular Weight | 637.67 g/mol |
| Exact Mass | 636.30 |
| IUPAC Name | trimethyl-[[2,2,3,3,5,5,6,6-octamethyl-1,4,4-tris(trimethylsilylmethyl)hexasilinan-1-yl]methyl]silane |
| SMILES | C[Si](C)(C)C[Si]1(C[Si](C)(C)C)[Si](C)(C)[Si](C)(C)[Si](C[Si](C)(C)C)(C[Si](C)(C)C)[Si](C)(C)[Si]1(C)C |
| InChI | InChI=1S/C24H68Si10/c1-25(2,3)21-33(22-26(4,5)6)29(13,14)31(17,18)34(23-27(7,8)9,24-28(10,11)12)32(19,20)30(33,15)16/h21-24H2,1-20H3 |
| InChIKey | WGCBXHJLPBRVMH-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.67 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|