C19H56Si10 — CID 139097582
[2,2,3,3,5,5,6,6,7,7,8,8-dodecamethyl-4-(trimethylsilylmethyl)-1,2,3,4,5,6,7,8-octasilabicyclo[2.2.2]octan-1-yl]-trimethylsilane (PubChem CID 139097582) has the molecular formula C19H56Si10 and a molecular weight of 565.52 g/mol. Its IUPAC name is [2,2,3,3,5,5,6,6,7,7,8,8-dodecamethyl-4-(trimethylsilylmethyl)-1,2,3,4,5,6,7,8-octasilabicyclo[2.2.2]octan-1-yl]-trimethylsilane.
| Compound Name | [2,2,3,3,5,5,6,6,7,7,8,8-dodecamethyl-4-(trimethylsilylmethyl)-1,2,3,4,5,6,7,8-octasilabicyclo[2.2.2]octan-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 139097582 |
| Molecular Formula | C19H56Si10 |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | [2,2,3,3,5,5,6,6,7,7,8,8-dodecamethyl-4-(trimethylsilylmethyl)-1,2,3,4,5,6,7,8-octasilabicyclo[2.2.2]octan-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C[Si]12[Si](C)(C)[Si](C)(C)[Si]([Si](C)(C)C)([Si](C)(C)[Si]1(C)C)[Si](C)(C)[Si]2(C)C |
| InChI | InChI=1S/C19H56Si10/c1-20(2,3)19-28-22(7,8)25(13,14)29(21(4,5)6,26(15,16)23(28,9)10)27(17,18)24(28,11)12/h19H2,1-18H3 |
| InChIKey | VRUXOLDQGHLFRB-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|