C10H30OSi6 — CID 6421179
1,2,2,3,3,4,5,5,6,6-decamethyl-7-oxa-1,2,3,4,5,6-hexasilabicyclo[2.2.1]heptane (PubChem CID 6421179) has the molecular formula C10H30OSi6 and a molecular weight of 334.87 g/mol. Its IUPAC name is 1,2,2,3,3,4,5,5,6,6-decamethyl-7-oxa-1,2,3,4,5,6-hexasilabicyclo[2.2.1]heptane.
| Compound Name | 1,2,2,3,3,4,5,5,6,6-decamethyl-7-oxa-1,2,3,4,5,6-hexasilabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 6421179 |
| Molecular Formula | C10H30OSi6 |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 1,2,2,3,3,4,5,5,6,6-decamethyl-7-oxa-1,2,3,4,5,6-hexasilabicyclo[2.2.1]heptane |
| SMILES | C[Si]1(C)[Si](C)(C)[Si]2(C)O[Si]1(C)[Si](C)(C)[Si]2(C)C |
| InChI | InChI=1S/C10H30OSi6/c1-12(2)13(3,4)17(10)11-16(12,9)14(5,6)15(17,7)8/h1-10H3 |
| InChIKey | RYMOFRGZFQVZTA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|