C26H44N6Zr — CID 139100173
[2-(dimethylamino)-2-(2,6-dimethylphenyl)iminoethyl]-(2,6-dimethylphenyl)azanide;tris(dimethylazanide);zirconium(4+) (PubChem CID 139100173) has the molecular formula C26H44N6Zr and a molecular weight of 531.90 g/mol. Its IUPAC name is [2-(dimethylamino)-2-(2,6-dimethylphenyl)iminoethyl]-(2,6-dimethylphenyl)azanide;tris(dimethylazanide);zirconium(4+).
| Compound Name | [2-(dimethylamino)-2-(2,6-dimethylphenyl)iminoethyl]-(2,6-dimethylphenyl)azanide;tris(dimethylazanide);zirconium(4+) |
|---|---|
| PubChem CID | 139100173 |
| Molecular Formula | C26H44N6Zr |
| Molecular Weight | 531.90 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | [2-(dimethylamino)-2-(2,6-dimethylphenyl)iminoethyl]-(2,6-dimethylphenyl)azanide;tris(dimethylazanide);zirconium(4+) |
| SMILES | C[N-]C.C[N-]C.C[N-]C.Cc1cccc(C)c1/N=C(/C[N-]c1c(C)cccc1C)N(C)C.[Zr+4] |
| InChI | InChI=1S/C20H26N3.3C2H6N.Zr/c1-14-9-7-10-15(2)19(14)21-13-18(23(5)6)22-20-16(3)11-8-12-17(20)4;3*1-3-2;/h7-12H,13H2,1-6H3;3*1-2H3;/q4*-1;+4/b22-18-;;;; |
| InChIKey | FAZOHHQURRNGLE-BLJMMOSVSA-N |
| XLogP | 7.07 |
| TPSA | 72.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.90 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|