C21H27N2- — CID 102509791
(2,6-dimethylphenyl)-[4-(2,6-dimethylphenyl)iminopentan-2-yl]azanide (PubChem CID 102509791) has the molecular formula C21H27N2- and a molecular weight of 307.46 g/mol. Its IUPAC name is (2,6-dimethylphenyl)-[4-(2,6-dimethylphenyl)iminopentan-2-yl]azanide.
| Compound Name | (2,6-dimethylphenyl)-[4-(2,6-dimethylphenyl)iminopentan-2-yl]azanide |
|---|---|
| PubChem CID | 102509791 |
| Molecular Formula | C21H27N2- |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | (2,6-dimethylphenyl)-[4-(2,6-dimethylphenyl)iminopentan-2-yl]azanide |
| SMILES | C/C(CC(C)[N-]c1c(C)cccc1C)=N\c1c(C)cccc1C |
| InChI | InChI=1S/C21H27N2/c1-14-9-7-10-15(2)20(14)22-18(5)13-19(6)23-21-16(3)11-8-12-17(21)4/h7-12,18H,13H2,1-6H3/q-1/b23-19+ |
| InChIKey | DQWBUZWKCQLEEQ-FCDQGJHFSA-N |
| XLogP | 6.50 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|