C24H45BN2OP2 — CID 139109508
ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2-hydroxy-1,3,2-benzodiazaborol-1-yl]methyl]phosphane (PubChem CID 139109508) has the molecular formula C24H45BN2OP2 and a molecular weight of 450.40 g/mol. Its IUPAC name is ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2-hydroxy-1,3,2-benzodiazaborol-1-yl]methyl]phosphane.
| Compound Name | ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2-hydroxy-1,3,2-benzodiazaborol-1-yl]methyl]phosphane |
|---|---|
| PubChem CID | 139109508 |
| Molecular Formula | C24H45BN2OP2 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2-hydroxy-1,3,2-benzodiazaborol-1-yl]methyl]phosphane |
| SMILES | CC(C)(C)P(CN1B(O)N(CP(C(C)(C)C)C(C)(C)C)c2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C24H45BN2OP2/c1-21(2,3)29(22(4,5)6)17-26-19-15-13-14-16-20(19)27(25(26)28)18-30(23(7,8)9)24(10,11)12/h13-16,28H,17-18H2,1-12H3 |
| InChIKey | NMLZHSZBTXKKKF-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|