C48H88B2N4P4 — CID 139121734
CID 139121734 (PubChem CID 139121734) has the molecular formula C48H88B2N4P4 and a molecular weight of 866.78 g/mol.
| Compound Name | CID 139121734 |
|---|---|
| PubChem CID | 139121734 |
| Molecular Formula | C48H88B2N4P4 |
| Molecular Weight | 866.78 g/mol |
| Exact Mass | 866.61 |
| IUPAC Name | — |
| SMILES | CC(C)(C)P(CN1[B]N(CP(C(C)(C)C)C(C)(C)C)c2ccccc21)C(C)(C)C.CC(C)(C)P(CN1[B]N(CP(C(C)(C)C)C(C)(C)C)c2ccccc21)C(C)(C)C |
| InChI | InChI=1S/2C24H44BN2P2/c2*1-21(2,3)28(22(4,5)6)17-26-19-15-13-14-16-20(19)27(25-26)18-29(23(7,8)9)24(10,11)12/h2*13-16H,17-18H2,1-12H3 |
| InChIKey | MYEBLKVUJNPMPG-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.78 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|