C11H19Cl2F3N3O3PSSi — CID 139113883
1-[dichloro(trimethylsilylimino)-λ5-phosphanyl]-N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate (PubChem CID 139113883) has the molecular formula C11H19Cl2F3N3O3PSSi and a molecular weight of 460.32 g/mol. Its IUPAC name is 1-[dichloro(trimethylsilylimino)-λ5-phosphanyl]-N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate.
| Compound Name | 1-[dichloro(trimethylsilylimino)-λ5-phosphanyl]-N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139113883 |
| Molecular Formula | C11H19Cl2F3N3O3PSSi |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | 1-[dichloro(trimethylsilylimino)-λ5-phosphanyl]-N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate |
| SMILES | CN(C)c1cc[n+](P(Cl)(Cl)=N[Si](C)(C)C)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C10H19Cl2N3PSi.CHF3O3S/c1-14(2)10-6-8-15(9-7-10)16(11,12)13-17(3,4)5;2-1(3,4)8(5,6)7/h6-9H,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | KYJVPUURZNVUNW-UHFFFAOYSA-M |
| XLogP | 4.20 |
| TPSA | 76.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|