C18H25ClO2 — CID 139114561
(1S,4aS,10aR)-6-chloro-1-(2-hydroxypropan-2-yl)-4a-methyl-2,3,4,9,10,10a-hexahydrophenanthren-1-ol (PubChem CID 139114561) has the molecular formula C18H25ClO2 and a molecular weight of 308.85 g/mol. Its IUPAC name is (1S,4aS,10aR)-6-chloro-1-(2-hydroxypropan-2-yl)-4a-methyl-2,3,4,9,10,10a-hexahydrophenanthren-1-ol.
| Compound Name | (1S,4aS,10aR)-6-chloro-1-(2-hydroxypropan-2-yl)-4a-methyl-2,3,4,9,10,10a-hexahydrophenanthren-1-ol |
|---|---|
| PubChem CID | 139114561 |
| Molecular Formula | C18H25ClO2 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (1S,4aS,10aR)-6-chloro-1-(2-hydroxypropan-2-yl)-4a-methyl-2,3,4,9,10,10a-hexahydrophenanthren-1-ol |
| SMILES | CC(C)(O)[C@]1(O)CCC[C@]2(C)c3cc(Cl)ccc3CC[C@H]21 |
| InChI | InChI=1S/C18H25ClO2/c1-16(2,20)18(21)10-4-9-17(3)14-11-13(19)7-5-12(14)6-8-15(17)18/h5,7,11,15,20-21H,4,6,8-10H2,1-3H3/t15-,17-,18+/m1/s1 |
| InChIKey | RUUTXIRDWKHKDM-NXHRZFHOSA-N |
| XLogP | 3.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |