C26H39ClO2 — CID 164613590
(2R,4aS,8aS)-1-[(E,3R)-5-(3-chlorophenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 164613590) has the molecular formula C26H39ClO2 and a molecular weight of 419.05 g/mol. Its IUPAC name is (2R,4aS,8aS)-1-[(E,3R)-5-(3-chlorophenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (2R,4aS,8aS)-1-[(E,3R)-5-(3-chlorophenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 164613590 |
| Molecular Formula | C26H39ClO2 |
| Molecular Weight | 419.05 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (2R,4aS,8aS)-1-[(E,3R)-5-(3-chlorophenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | CC1(C)CCC[C@]2(C)C(CC[C@@](C)(O)/C=C/c3cccc(Cl)c3)[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C26H39ClO2/c1-23(2)13-7-14-25(4)21(23)12-17-26(5,29)22(25)11-16-24(3,28)15-10-19-8-6-9-20(27)18-19/h6,8-10,15,18,21-22,28-29H,7,11-14,16-17H2,1-5H3/b15-10+/t21-,22?,24-,25-,26+/m0/s1 |
| InChIKey | IJXAZRACWMPCGW-BDNANJATSA-N |
| XLogP | 6.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.05 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |