C23H31ClO2 — CID 155521607
(1R,2R,4aS,5R,8aS)-5-[(E)-3-(3-chlorophenyl)prop-2-enyl]-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol (PubChem CID 155521607) has the molecular formula C23H31ClO2 and a molecular weight of 374.95 g/mol. Its IUPAC name is (1R,2R,4aS,5R,8aS)-5-[(E)-3-(3-chlorophenyl)prop-2-enyl]-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (1R,2R,4aS,5R,8aS)-5-[(E)-3-(3-chlorophenyl)prop-2-enyl]-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 155521607 |
| Molecular Formula | C23H31ClO2 |
| Molecular Weight | 374.95 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (1R,2R,4aS,5R,8aS)-5-[(E)-3-(3-chlorophenyl)prop-2-enyl]-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
| SMILES | C=C1CC[C@@H]2[C@](C)(CO)[C@H](O)CC[C@@]2(C)[C@@H]1C/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H31ClO2/c1-16-10-11-20-22(2,13-12-21(26)23(20,3)15-25)19(16)9-5-7-17-6-4-8-18(24)14-17/h4-8,14,19-21,25-26H,1,9-13,15H2,2-3H3/b7-5+/t19-,20+,21-,22+,23+/m1/s1 |
| InChIKey | ZAHXTIHTDSWLFD-CLFFOPILSA-N |
| XLogP | 5.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.95 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|