C26H24N4O4S4 — CID 139115168
2-(6-methoxy-1,3-benzothiazol-2-yl)-5,5-dimethyl-1,3-thiazol-4-one (PubChem CID 139115168) has the molecular formula C26H24N4O4S4 and a molecular weight of 584.77 g/mol. Its IUPAC name is 2-(6-methoxy-1,3-benzothiazol-2-yl)-5,5-dimethyl-1,3-thiazol-4-one.
| Compound Name | 2-(6-methoxy-1,3-benzothiazol-2-yl)-5,5-dimethyl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 139115168 |
| Molecular Formula | C26H24N4O4S4 |
| Molecular Weight | 584.77 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | 2-(6-methoxy-1,3-benzothiazol-2-yl)-5,5-dimethyl-1,3-thiazol-4-one |
| SMILES | COc1ccc2nc(C3=NC(=O)C(C)(C)S3)sc2c1.COc1ccc2nc(C3=NC(=O)C(C)(C)S3)sc2c1 |
| InChI | InChI=1S/2C13H12N2O2S2/c2*1-13(2)12(16)15-11(19-13)10-14-8-5-4-7(17-3)6-9(8)18-10/h2*4-6H,1-3H3 |
| InChIKey | QJQWCOLVXKWOEV-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 103.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.77 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |