C41H57BN2O2S2 — CID 139115630
[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-(6-phenylmethoxyhexoxycarbothioylsulfanyl)boranuide (PubChem CID 139115630) has the molecular formula C41H57BN2O2S2 and a molecular weight of 684.86 g/mol. Its IUPAC name is [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-(6-phenylmethoxyhexoxycarbothioylsulfanyl)boranuide.
| Compound Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-(6-phenylmethoxyhexoxycarbothioylsulfanyl)boranuide |
|---|---|
| PubChem CID | 139115630 |
| Molecular Formula | C41H57BN2O2S2 |
| Molecular Weight | 684.86 g/mol |
| Exact Mass | 684.40 |
| IUPAC Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-(6-phenylmethoxyhexoxycarbothioylsulfanyl)boranuide |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1[BH2-]SC(=S)OCCCCCCOCc1ccccc1 |
| InChI | InChI=1S/C41H57BN2O2S2/c1-29(2)34-20-16-21-35(30(3)4)38(34)43-24-25-44(39-36(31(5)6)22-17-23-37(39)32(7)8)40(43)42-48-41(47)46-27-15-10-9-14-26-45-28-33-18-12-11-13-19-33/h11-13,16-25,29-32H,9-10,14-15,26-28,42H2,1-8H3 |
| InChIKey | SIRAWVVNEBZFBL-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.86 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|