C30H20O8 — CID 139116216
(1R,11R,20R,21S)-5,7,16,24-tetrahydroxyoctacyclo[19.7.1.12,6.01,11.011,20.012,17.023,28.010,30]triaconta-2,4,6,8,10(30),12(17),13,15,23(28),24,26-undecaene-18,22,29-trione;hydrate (PubChem CID 139116216) has the molecular formula C30H20O8 and a molecular weight of 508.48 g/mol. Its IUPAC name is (1R,11R,20R,21S)-5,7,16,24-tetrahydroxyoctacyclo[19.7.1.12,6.01,11.011,20.012,17.023,28.010,30]triaconta-2,4,6,8,10(30),12(17),13,15,23(28),24,26-undecaene-18,22,29-trione;hydrate.
| Compound Name | (1R,11R,20R,21S)-5,7,16,24-tetrahydroxyoctacyclo[19.7.1.12,6.01,11.011,20.012,17.023,28.010,30]triaconta-2,4,6,8,10(30),12(17),13,15,23(28),24,26-undecaene-18,22,29-trione;hydrate |
|---|---|
| PubChem CID | 139116216 |
| Molecular Formula | C30H20O8 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | (1R,11R,20R,21S)-5,7,16,24-tetrahydroxyoctacyclo[19.7.1.12,6.01,11.011,20.012,17.023,28.010,30]triaconta-2,4,6,8,10(30),12(17),13,15,23(28),24,26-undecaene-18,22,29-trione;hydrate |
| SMILES | O.O=C1C[C@@H]2[C@@H]3C(=O)c4c(O)cccc4[C@]4(C3=O)c3ccc(O)c5c(O)ccc(c35)[C@@]24c2cccc(O)c21 |
| InChI | InChI=1S/C30H18O7.H2O/c31-17-5-1-3-12-23(17)21(35)11-16-25-27(36)24-13(4-2-6-18(24)32)30(28(25)37)15-8-10-20(34)26-19(33)9-7-14(22(15)26)29(12,16)30;/h1-10,16,25,31-34H,11H2;1H2/t16-,25-,29+,30-;/m1./s1 |
| InChIKey | HZRUHMLMOJEFTM-BJNLXPQFSA-N |
| XLogP | 3.02 |
| TPSA | 163.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|