C20H28NPSi2 — CID 139121419
N,N-bis(trimethylsilyl)-15-phosphatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaen-15-amine (PubChem CID 139121419) has the molecular formula C20H28NPSi2 and a molecular weight of 369.60 g/mol. Its IUPAC name is N,N-bis(trimethylsilyl)-15-phosphatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaen-15-amine.
| Compound Name | N,N-bis(trimethylsilyl)-15-phosphatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaen-15-amine |
|---|---|
| PubChem CID | 139121419 |
| Molecular Formula | C20H28NPSi2 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N,N-bis(trimethylsilyl)-15-phosphatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaen-15-amine |
| SMILES | C[Si](C)(C)N(P1C2c3ccccc3C1c1ccccc12)[Si](C)(C)C |
| InChI | InChI=1S/C20H28NPSi2/c1-23(2,3)21(24(4,5)6)22-19-15-11-7-8-12-16(15)20(22)18-14-10-9-13-17(18)19/h7-14,19-20H,1-6H3 |
| InChIKey | LTYHVTVWMVXGIU-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|