C17H17NP+ — CID 134863151
17,17-dimethyl-17-azonia-1-phosphapentacyclo[7.7.1.02,16.03,8.010,15]heptadeca-3,5,7,10,12,14-hexaene (PubChem CID 134863151) has the molecular formula C17H17NP+ and a molecular weight of 266.30 g/mol. Its IUPAC name is 17,17-dimethyl-17-azonia-1-phosphapentacyclo[7.7.1.02,16.03,8.010,15]heptadeca-3,5,7,10,12,14-hexaene.
| Compound Name | 17,17-dimethyl-17-azonia-1-phosphapentacyclo[7.7.1.02,16.03,8.010,15]heptadeca-3,5,7,10,12,14-hexaene |
|---|---|
| PubChem CID | 134863151 |
| Molecular Formula | C17H17NP+ |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 17,17-dimethyl-17-azonia-1-phosphapentacyclo[7.7.1.02,16.03,8.010,15]heptadeca-3,5,7,10,12,14-hexaene |
| SMILES | C[N+]1(C)C2c3ccccc3C3C(c4ccccc42)P31 |
| InChI | InChI=1S/C17H17NP/c1-18(2)15-11-7-3-5-9-13(11)16-17(19(16)18)14-10-6-4-8-12(14)15/h3-10,15-17H,1-2H3/q+1 |
| InChIKey | NDQJAPKXOJQPQZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|