C30H42B3Cl6N3 — CID 139135435
(9R)-7,7-dichloro-8,8,9-trimethyl-8-azonia-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene (PubChem CID 139135435) has the molecular formula C30H42B3Cl6N3 and a molecular weight of 689.84 g/mol. Its IUPAC name is (9R)-7,7-dichloro-8,8,9-trimethyl-8-azonia-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene.
| Compound Name | (9R)-7,7-dichloro-8,8,9-trimethyl-8-azonia-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene |
|---|---|
| PubChem CID | 139135435 |
| Molecular Formula | C30H42B3Cl6N3 |
| Molecular Weight | 689.84 g/mol |
| Exact Mass | 687.18 |
| IUPAC Name | (9R)-7,7-dichloro-8,8,9-trimethyl-8-azonia-7-boranuidabicyclo[4.3.0]nona-1,3,5-triene |
| SMILES | C[C@@H]1c2ccccc2[B-](Cl)(Cl)[N+]1(C)C.C[C@@H]1c2ccccc2[B-](Cl)(Cl)[N+]1(C)C.C[C@@H]1c2ccccc2[B-](Cl)(Cl)[N+]1(C)C |
| InChI | InChI=1S/3C10H14BCl2N/c3*1-8-9-6-4-5-7-10(9)11(12,13)14(8,2)3/h3*4-8H,1-3H3/t3*8-/m111/s1 |
| InChIKey | QUZVWZRGFMFNLL-XSUUSZEGSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.84 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|