C25H25BN2O2 — CID 139142899
4,6,10,12-tetramethyl-8-phenyl-2,2-bis(prop-2-ynoxy)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139142899) has the molecular formula C25H25BN2O2 and a molecular weight of 396.30 g/mol. Its IUPAC name is 4,6,10,12-tetramethyl-8-phenyl-2,2-bis(prop-2-ynoxy)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 4,6,10,12-tetramethyl-8-phenyl-2,2-bis(prop-2-ynoxy)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139142899 |
| Molecular Formula | C25H25BN2O2 |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 4,6,10,12-tetramethyl-8-phenyl-2,2-bis(prop-2-ynoxy)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | C#CCO[B-]1(OCC#C)n2c(C)cc(C)c2C(c2ccccc2)=C2C(C)=CC(C)=[N+]21 |
| InChI | InChI=1S/C25H25BN2O2/c1-7-14-29-26(30-15-8-2)27-20(5)16-18(3)24(27)23(22-12-10-9-11-13-22)25-19(4)17-21(6)28(25)26/h1-2,9-13,16-17H,14-15H2,3-6H3 |
| InChIKey | BURYSRYFPOQWSL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|