C45H44B2F2N2 — CID 56651885
[4-[2-(2,2-difluoro-4,6,10,12-tetramethyl-8-phenyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl)ethynyl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 56651885) has the molecular formula C45H44B2F2N2 and a molecular weight of 672.48 g/mol. Its IUPAC name is [4-[2-(2,2-difluoro-4,6,10,12-tetramethyl-8-phenyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl)ethynyl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-[2-(2,2-difluoro-4,6,10,12-tetramethyl-8-phenyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl)ethynyl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 56651885 |
| Molecular Formula | C45H44B2F2N2 |
| Molecular Weight | 672.48 g/mol |
| Exact Mass | 672.37 |
| IUPAC Name | [4-[2-(2,2-difluoro-4,6,10,12-tetramethyl-8-phenyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-5-yl)ethynyl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | CC1=C(C#Cc2ccc(B(c3c(C)cc(C)cc3C)c3c(C)cc(C)cc3C)cc2)C(C)=[N+]2C1=C(c1ccccc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C45H44B2F2N2/c1-27-22-29(3)42(30(4)23-27)46(43-31(5)24-28(2)25-32(43)6)39-19-16-37(17-20-39)18-21-40-35(9)45-41(38-14-12-11-13-15-38)44-33(7)26-34(8)50(44)47(48,49)51(45)36(40)10/h11-17,19-20,22-26H,1-10H3 |
| InChIKey | RSEBSIIUYIKYKO-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.48 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|