C15H18Cl2N4O2 — CID 139170895
1-(3-chloroquinoxalin-2-yl)-N,N-dimethylpyridin-1-ium-4-amine;chloride;dihydrate (PubChem CID 139170895) has the molecular formula C15H18Cl2N4O2 and a molecular weight of 357.24 g/mol. Its IUPAC name is 1-(3-chloroquinoxalin-2-yl)-N,N-dimethylpyridin-1-ium-4-amine;chloride;dihydrate.
| Compound Name | 1-(3-chloroquinoxalin-2-yl)-N,N-dimethylpyridin-1-ium-4-amine;chloride;dihydrate |
|---|---|
| PubChem CID | 139170895 |
| Molecular Formula | C15H18Cl2N4O2 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1-(3-chloroquinoxalin-2-yl)-N,N-dimethylpyridin-1-ium-4-amine;chloride;dihydrate |
| SMILES | CN(C)c1cc[n+](-c2nc3ccccc3nc2Cl)cc1.O.O.[Cl-] |
| InChI | InChI=1S/C15H14ClN4.ClH.2H2O/c1-19(2)11-7-9-20(10-8-11)15-14(16)17-12-5-3-4-6-13(12)18-15;;;/h3-10H,1-2H3;1H;2*1H2/q+1;;;/p-1 |
| InChIKey | POJVTZKZBLMOQI-UHFFFAOYSA-M |
| XLogP | -2.02 |
| TPSA | 95.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|