C26H30N10S2 — CID 139175591
2,4-dimethyl-6-quinolin-8-yl-1,2,4,5-tetrazinane-3-thione (PubChem CID 139175591) has the molecular formula C26H30N10S2 and a molecular weight of 546.73 g/mol. Its IUPAC name is 2,4-dimethyl-6-quinolin-8-yl-1,2,4,5-tetrazinane-3-thione.
| Compound Name | 2,4-dimethyl-6-quinolin-8-yl-1,2,4,5-tetrazinane-3-thione |
|---|---|
| PubChem CID | 139175591 |
| Molecular Formula | C26H30N10S2 |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 2,4-dimethyl-6-quinolin-8-yl-1,2,4,5-tetrazinane-3-thione |
| SMILES | CN1NC(c2cccc3cccnc23)NN(C)C1=S.CN1NC(c2cccc3cccnc23)NN(C)C1=S |
| InChI | InChI=1S/2C13H15N5S/c2*1-17-13(19)18(2)16-12(15-17)10-7-3-5-9-6-4-8-14-11(9)10/h2*3-8,12,15-16H,1-2H3 |
| InChIKey | PTYJGDDFELIOSP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|