C18H22ClCuN3O6 — CID 139177156
copper;2-[2-[3-hydroxypropyl(pyridin-2-ylmethyl)amino]ethyliminomethyl]phenolate;perchlorate (PubChem CID 139177156) has the molecular formula C18H22ClCuN3O6 and a molecular weight of 475.39 g/mol. Its IUPAC name is copper;2-[2-[3-hydroxypropyl(pyridin-2-ylmethyl)amino]ethyliminomethyl]phenolate;perchlorate.
| Compound Name | copper;2-[2-[3-hydroxypropyl(pyridin-2-ylmethyl)amino]ethyliminomethyl]phenolate;perchlorate |
|---|---|
| PubChem CID | 139177156 |
| Molecular Formula | C18H22ClCuN3O6 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | copper;2-[2-[3-hydroxypropyl(pyridin-2-ylmethyl)amino]ethyliminomethyl]phenolate;perchlorate |
| SMILES | [Cu+2].[O-][Cl+3]([O-])([O-])[O-].[O-]c1ccccc1/C=N\CCN(CCCO)Cc1ccccn1 |
| InChI | InChI=1S/C18H23N3O2.ClHO4.Cu/c22-13-5-11-21(15-17-7-3-4-9-20-17)12-10-19-14-16-6-1-2-8-18(16)23;2-1(3,4)5;/h1-4,6-9,14,22-23H,5,10-13,15H2;(H,2,3,4,5);/q;;+2/p-2/b19-14-;; |
| InChIKey | YSBJXYFMSQPUMF-MHZTUVSFSA-L |
| XLogP | -3.30 |
| TPSA | 164.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|