C32H38N6O2 — CID 136784633
2-[[5-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]-3-hydroxypentyl]iminomethyl]phenol (PubChem CID 136784633) has the molecular formula C32H38N6O2 and a molecular weight of 538.70 g/mol. Its IUPAC name is 2-[[5-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]-3-hydroxypentyl]iminomethyl]phenol.
| Compound Name | 2-[[5-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]-3-hydroxypentyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136784633 |
| Molecular Formula | C32H38N6O2 |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | 2-[[5-[2-[bis(pyridin-2-ylmethyl)amino]ethyl-(pyridin-2-ylmethyl)amino]-3-hydroxypentyl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/CCC(O)CCN(CCN(Cc1ccccn1)Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C32H38N6O2/c39-31(14-19-33-23-27-9-1-2-13-32(27)40)15-20-37(24-28-10-3-6-16-34-28)21-22-38(25-29-11-4-7-17-35-29)26-30-12-5-8-18-36-30/h1-13,16-18,23,31,39-40H,14-15,19-22,24-26H2/b33-23+ |
| InChIKey | NSNIQSJISABDSH-GZZLJNBRSA-N |
| XLogP | 4.34 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|