C42H38O6 — CID 139180460
2,4-bis[(E)-prop-1-enyl]cyclobutane-1,3-dicarboxylic acid;1,1,6,6-tetraphenylhexa-2,4-diyne-1,6-diol (PubChem CID 139180460) has the molecular formula C42H38O6 and a molecular weight of 638.76 g/mol. Its IUPAC name is 2,4-bis[(E)-prop-1-enyl]cyclobutane-1,3-dicarboxylic acid;1,1,6,6-tetraphenylhexa-2,4-diyne-1,6-diol.
| Compound Name | 2,4-bis[(E)-prop-1-enyl]cyclobutane-1,3-dicarboxylic acid;1,1,6,6-tetraphenylhexa-2,4-diyne-1,6-diol |
|---|---|
| PubChem CID | 139180460 |
| Molecular Formula | C42H38O6 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | 2,4-bis[(E)-prop-1-enyl]cyclobutane-1,3-dicarboxylic acid;1,1,6,6-tetraphenylhexa-2,4-diyne-1,6-diol |
| SMILES | C/C=C/[C@H]1[C@H](C(=O)O)[C@@H](/C=C/C)[C@@H]1C(=O)O.OC(C#CC#CC(O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H22O2.C12H16O4/c31-29(25-15-5-1-6-16-25,26-17-7-2-8-18-26)23-13-14-24-30(32,27-19-9-3-10-20-27)28-21-11-4-12-22-28;1-3-5-7-9(11(13)14)8(6-4-2)10(7)12(15)16/h1-12,15-22,31-32H;3-10H,1-2H3,(H,13,14)(H,15,16)/b;5-3+,6-4+/t;7-,8+,9-,10+ |
| InChIKey | WDSVEDCTIPJQIZ-NXYYWIJISA-N |
| XLogP | 6.65 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|