C18H19IN2 — CID 139185606
(3aS)-2-[(1S)-1-phenylethyl]-3a,4-dihydro-3H-imidazo[1,5-a]indol-2-ium iodide (PubChem CID 139185606) has the molecular formula C18H19IN2 and a molecular weight of 390.27 g/mol. Its IUPAC name is (3aS)-2-[(1S)-1-phenylethyl]-3a,4-dihydro-3H-imidazo[1,5-a]indol-2-ium iodide.
| Compound Name | (3aS)-2-[(1S)-1-phenylethyl]-3a,4-dihydro-3H-imidazo[1,5-a]indol-2-ium iodide |
|---|---|
| PubChem CID | 139185606 |
| Molecular Formula | C18H19IN2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | (3aS)-2-[(1S)-1-phenylethyl]-3a,4-dihydro-3H-imidazo[1,5-a]indol-2-ium iodide |
| SMILES | C[C@@H](c1ccccc1)[N+]1=CN2c3ccccc3C[C@H]2C1.[I-] |
| InChI | InChI=1S/C18H19N2.HI/c1-14(15-7-3-2-4-8-15)19-12-17-11-16-9-5-6-10-18(16)20(17)13-19;/h2-10,13-14,17H,11-12H2,1H3;1H/q+1;/p-1/t14-,17-;/m0./s1 |
| InChIKey | NLSJFYOFYYHBAC-RVXRQPKJSA-M |
| XLogP | 0.24 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|