C15H10F4N4O3 — CID 139196662
1-(4-aminophenyl)ethanone;4-azido-2,3,5,6-tetrafluorobenzoic acid (PubChem CID 139196662) has the molecular formula C15H10F4N4O3 and a molecular weight of 370.26 g/mol. Its IUPAC name is 1-(4-aminophenyl)ethanone;4-azido-2,3,5,6-tetrafluorobenzoic acid.
| Compound Name | 1-(4-aminophenyl)ethanone;4-azido-2,3,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 139196662 |
| Molecular Formula | C15H10F4N4O3 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 1-(4-aminophenyl)ethanone;4-azido-2,3,5,6-tetrafluorobenzoic acid |
| SMILES | CC(=O)c1ccc(N)cc1.[N-]=[N+]=Nc1c(F)c(F)c(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C8H9NO.C7HF4N3O2/c1-6(10)7-2-4-8(9)5-3-7;8-2-1(7(15)16)3(9)5(11)6(4(2)10)13-14-12/h2-5H,9H2,1H3;(H,15,16) |
| InChIKey | QJJBRSNPLWIQCD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|