C35H20F3NO — CID 139232878
4,6,8-tris(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline (PubChem CID 139232878) has the molecular formula C35H20F3NO and a molecular weight of 527.55 g/mol. Its IUPAC name is 4,6,8-tris(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline.
| Compound Name | 4,6,8-tris(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 139232878 |
| Molecular Formula | C35H20F3NO |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 4,6,8-tris(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline |
| SMILES | Fc1ccc(-c2cc(-c3ccc(F)cc3)c3nc(-c4ccc(F)cc4)c4cc(-c5ccccc5)oc4c3c2)cc1 |
| InChI | InChI=1S/C35H20F3NO/c36-26-12-6-21(7-13-26)25-18-29(22-8-14-27(37)15-9-22)34-30(19-25)35-31(20-32(40-35)23-4-2-1-3-5-23)33(39-34)24-10-16-28(38)17-11-24/h1-20H |
| InChIKey | IYKOHEQSPGJWPE-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |