C20H32Si — CID 139241203
5-butyl-1,1-bis(hex-1-ynyl)-2,3-dihydrosilole (PubChem CID 139241203) has the molecular formula C20H32Si and a molecular weight of 300.56 g/mol. Its IUPAC name is 5-butyl-1,1-bis(hex-1-ynyl)-2,3-dihydrosilole.
| Compound Name | 5-butyl-1,1-bis(hex-1-ynyl)-2,3-dihydrosilole |
|---|---|
| PubChem CID | 139241203 |
| Molecular Formula | C20H32Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 5-butyl-1,1-bis(hex-1-ynyl)-2,3-dihydrosilole |
| SMILES | CCCCC#C[Si]1(C#CCCCC)CCC=C1CCCC |
| InChI | InChI=1S/C20H32Si/c1-4-7-10-12-17-21(18-13-11-8-5-2)19-14-16-20(21)15-9-6-3/h16H,4-11,14-15,19H2,1-3H3 |
| InChIKey | SLGYTTYRDQZBID-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|