C33H40ClN2PPd — CID 139241603
chloropalladium(1+);N,N-dimethyl-1-phenylmethanamine;N-diphenylphosphanyl-2,6-di(propan-2-yl)aniline (PubChem CID 139241603) has the molecular formula C33H40ClN2PPd and a molecular weight of 637.54 g/mol. Its IUPAC name is chloropalladium(1+);N,N-dimethyl-1-phenylmethanamine;N-diphenylphosphanyl-2,6-di(propan-2-yl)aniline.
| Compound Name | chloropalladium(1+);N,N-dimethyl-1-phenylmethanamine;N-diphenylphosphanyl-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 139241603 |
| Molecular Formula | C33H40ClN2PPd |
| Molecular Weight | 637.54 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | chloropalladium(1+);N,N-dimethyl-1-phenylmethanamine;N-diphenylphosphanyl-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1NP(c1ccccc1)c1ccccc1.CN(C)Cc1[c-]cccc1.Cl[Pd+] |
| InChI | InChI=1S/C24H28NP.C9H12N.ClH.Pd/c1-18(2)22-16-11-17-23(19(3)4)24(22)25-26(20-12-7-5-8-13-20)21-14-9-6-10-15-21;1-10(2)8-9-6-4-3-5-7-9;;/h5-19,25H,1-4H3;3-6H,8H2,1-2H3;1H;/q;-1;;+2/p-1 |
| InChIKey | JQSSGUFTZQOIMZ-UHFFFAOYSA-M |
| XLogP | 8.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.54 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|