C19H19BF10N2 — CID 139245690
methyl-[4-[[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-(2,2,2-trifluoroethyl)azanium tetrafluoroborate (PubChem CID 139245690) has the molecular formula C19H19BF10N2 and a molecular weight of 476.17 g/mol. Its IUPAC name is methyl-[4-[[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-(2,2,2-trifluoroethyl)azanium tetrafluoroborate.
| Compound Name | methyl-[4-[[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-(2,2,2-trifluoroethyl)azanium tetrafluoroborate |
|---|---|
| PubChem CID | 139245690 |
| Molecular Formula | C19H19BF10N2 |
| Molecular Weight | 476.17 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | methyl-[4-[[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-(2,2,2-trifluoroethyl)azanium tetrafluoroborate |
| SMILES | CN(CC(F)(F)F)c1ccc(C=C2C=CC(=[N+](C)CC(F)(F)F)C=C2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C19H19F6N2.BF4/c1-26(12-18(20,21)22)16-7-3-14(4-8-16)11-15-5-9-17(10-6-15)27(2)13-19(23,24)25;2-1(3,4)5/h3-11H,12-13H2,1-2H3;/q+1;-1 |
| InChIKey | GJANYNOFRLZGIY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.17 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|