C26H25F6N3O3 — CID 100990186
4-[methoxy-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]-(3-nitrophenyl)methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 100990186) has the molecular formula C26H25F6N3O3 and a molecular weight of 541.49 g/mol. Its IUPAC name is 4-[methoxy-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]-(3-nitrophenyl)methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-[methoxy-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]-(3-nitrophenyl)methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 100990186 |
| Molecular Formula | C26H25F6N3O3 |
| Molecular Weight | 541.49 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 4-[methoxy-[4-[methyl(2,2,2-trifluoroethyl)amino]phenyl]-(3-nitrophenyl)methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | COC(c1ccc(N(C)CC(F)(F)F)cc1)(c1ccc(N(C)CC(F)(F)F)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H25F6N3O3/c1-33(16-24(27,28)29)21-11-7-18(8-12-21)26(38-3,20-5-4-6-23(15-20)35(36)37)19-9-13-22(14-10-19)34(2)17-25(30,31)32/h4-15H,16-17H2,1-3H3 |
| InChIKey | JFEQJQRXCDCDER-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.49 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|