C26H52O3Si — CID 139253924
(2S,4R)-4-[(1S,3R,4R)-2,2-diethyl-4-prop-1-en-2-yl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol (PubChem CID 139253924) has the molecular formula C26H52O3Si and a molecular weight of 440.79 g/mol. Its IUPAC name is (2S,4R)-4-[(1S,3R,4R)-2,2-diethyl-4-prop-1-en-2-yl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol.
| Compound Name | (2S,4R)-4-[(1S,3R,4R)-2,2-diethyl-4-prop-1-en-2-yl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol |
|---|---|
| PubChem CID | 139253924 |
| Molecular Formula | C26H52O3Si |
| Molecular Weight | 440.79 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | (2S,4R)-4-[(1S,3R,4R)-2,2-diethyl-4-prop-1-en-2-yl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol |
| SMILES | C=C(C)[C@H]1C[C@H](O[C@H](C)C[C@H](C)O)C(CC)(CC)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H52O3Si/c1-13-26(14-2)24(28-22(12)15-21(11)27)16-23(17(3)4)25(26)29-30(18(5)6,19(7)8)20(9)10/h18-25,27H,3,13-16H2,1-2,4-12H3/t21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | KNSPCGGFPMLCGL-VCDBXAJLSA-N |
| XLogP | 7.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.79 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|