C28H36N8O4S2 — CID 139259194
(2R)-2-(3-azidopropyl)-4-[(2R,5R)-5-(3-azidopropyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole (PubChem CID 139259194) has the molecular formula C28H36N8O4S2 and a molecular weight of 612.78 g/mol. Its IUPAC name is (2R)-2-(3-azidopropyl)-4-[(2R,5R)-5-(3-azidopropyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole.
| Compound Name | (2R)-2-(3-azidopropyl)-4-[(2R,5R)-5-(3-azidopropyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 139259194 |
| Molecular Formula | C28H36N8O4S2 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | (2R)-2-(3-azidopropyl)-4-[(2R,5R)-5-(3-azidopropyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2C=C([C@H]3CC[C@@H](CCCN=[N+]=[N-])N3S(=O)(=O)c3ccc(C)cc3)C[C@H]2CCCN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C28H36N8O4S2/c1-21-7-12-26(13-8-21)41(37,38)35-20-23(19-25(35)6-4-18-32-34-30)28-16-11-24(5-3-17-31-33-29)36(28)42(39,40)27-14-9-22(2)10-15-27/h7-10,12-15,20,24-25,28H,3-6,11,16-19H2,1-2H3/t24-,25-,28-/m1/s1 |
| InChIKey | SXOZDTDWDIABQR-INNMJMHTSA-N |
| XLogP | 6.35 |
| TPSA | 172.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|