About 2H-3,1-benzoselenazin-2-amine
2H-3,1-benzoselenazin-2-amine (PubChem CID 139266837) has the molecular formula C8H8N2Se
and a molecular weight of 211.13 g/mol. Its IUPAC name is 2H-3,1-benzoselenazin-2-amine.
Molecular Properties
| Compound Name | 2H-3,1-benzoselenazin-2-amine |
| PubChem CID | 139266837 |
| Molecular Formula | C8H8N2Se |
| Molecular Weight | 211.13 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 2H-3,1-benzoselenazin-2-amine |
| SMILES | NC1N=c2ccccc2=C[Se]1 |
| InChI | InChI=1S/C8H8N2Se/c9-8-10-7-4-2-1-3-6(7)5-11-8/h1-5,8H,9H2 |
| InChIKey | WWJSQQDUVXJZAW-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.13 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2H-3,1-benzoselenazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-3,1-benzoselenazin-2-amine?
The IUPAC name of 2H-3,1-benzoselenazin-2-amine (CID 139266837) is 2H-3,1-benzoselenazin-2-amine.
What is the SMILES notation for 2H-3,1-benzoselenazin-2-amine?
The canonical SMILES for 2H-3,1-benzoselenazin-2-amine is NC1N=c2ccccc2=C[Se]1.
What is the InChIKey of 2H-3,1-benzoselenazin-2-amine?
The InChIKey is WWJSQQDUVXJZAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2Se/c9-8-10-7-4-2-1-3-6(7)5-11-8/h1-5,8H,9H2.
What are the key properties of 2H-3,1-benzoselenazin-2-amine?
2H-3,1-benzoselenazin-2-amine has a molecular weight of 211.13 g/mol, XLogP of -1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-3,1-benzoselenazin-2-amine is sourced from PubChem (CID 139266837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).